C18H29NO3 — CID 169113842
tert-butyl N-[(4E)-5-methoxy-3-methylidenehepta-1,4,6-trien-2-yl]-N-(2-methylpropyl)carbamate (PubChem CID 169113842) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is tert-butyl N-[(4E)-5-methoxy-3-methylidenehepta-1,4,6-trien-2-yl]-N-(2-methylpropyl)carbamate.
| Compound Name | tert-butyl N-[(4E)-5-methoxy-3-methylidenehepta-1,4,6-trien-2-yl]-N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 169113842 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | tert-butyl N-[(4E)-5-methoxy-3-methylidenehepta-1,4,6-trien-2-yl]-N-(2-methylpropyl)carbamate |
| SMILES | C=C/C(=C\C(=C)C(=C)N(CC(C)C)C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C18H29NO3/c1-10-16(21-9)11-14(4)15(5)19(12-13(2)3)17(20)22-18(6,7)8/h10-11,13H,1,4-5,12H2,2-3,6-9H3/b16-11+ |
| InChIKey | PXAZAKFLZGAYEA-LFIBNONCSA-N |
| XLogP | 4.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|