C18H20F3NO4 — CID 169114001
2,2,2-trifluoroethyl 2-[2-(2,3-dihydro-1-benzofuran-6-yl)-5-methylpiperidin-1-yl]-2-oxoacetate (PubChem CID 169114001) has the molecular formula C18H20F3NO4 and a molecular weight of 371.36 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[2-(2,3-dihydro-1-benzofuran-6-yl)-5-methylpiperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[2-(2,3-dihydro-1-benzofuran-6-yl)-5-methylpiperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169114001 |
| Molecular Formula | C18H20F3NO4 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[2-(2,3-dihydro-1-benzofuran-6-yl)-5-methylpiperidin-1-yl]-2-oxoacetate |
| SMILES | CC1CCC(c2ccc3c(c2)OCC3)N(C(=O)C(=O)OCC(F)(F)F)C1 |
| InChI | InChI=1S/C18H20F3NO4/c1-11-2-5-14(13-4-3-12-6-7-25-15(12)8-13)22(9-11)16(23)17(24)26-10-18(19,20)21/h3-4,8,11,14H,2,5-7,9-10H2,1H3 |
| InChIKey | IGABPEBZUCVZEZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|