C19H30F3NO3 — CID 169114005
2,2,2-trifluoroethyl 2-[(2R,5S)-2-(cyclooctylmethyl)-5-methylpiperidin-1-yl]-2-oxoacetate (PubChem CID 169114005) has the molecular formula C19H30F3NO3 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(2R,5S)-2-(cyclooctylmethyl)-5-methylpiperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(2R,5S)-2-(cyclooctylmethyl)-5-methylpiperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169114005 |
| Molecular Formula | C19H30F3NO3 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(2R,5S)-2-(cyclooctylmethyl)-5-methylpiperidin-1-yl]-2-oxoacetate |
| SMILES | C[C@H]1CC[C@H](CC2CCCCCCC2)N(C(=O)C(=O)OCC(F)(F)F)C1 |
| InChI | InChI=1S/C19H30F3NO3/c1-14-9-10-16(11-15-7-5-3-2-4-6-8-15)23(12-14)17(24)18(25)26-13-19(20,21)22/h14-16H,2-13H2,1H3/t14-,16+/m0/s1 |
| InChIKey | DSOTZMNYOPTVGU-GOEBONIOSA-N |
| XLogP | 4.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|