C14H17N5O2 — CID 169114106
2-(3-methylpiperidin-1-yl)-2-oxo-N-(1H-pyrazolo[3,4-c]pyridin-4-yl)acetamide (PubChem CID 169114106) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-(3-methylpiperidin-1-yl)-2-oxo-N-(1H-pyrazolo[3,4-c]pyridin-4-yl)acetamide.
| Compound Name | 2-(3-methylpiperidin-1-yl)-2-oxo-N-(1H-pyrazolo[3,4-c]pyridin-4-yl)acetamide |
|---|---|
| PubChem CID | 169114106 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-(3-methylpiperidin-1-yl)-2-oxo-N-(1H-pyrazolo[3,4-c]pyridin-4-yl)acetamide |
| SMILES | CC1CCCN(C(=O)C(=O)Nc2cncc3[nH]ncc23)C1 |
| InChI | InChI=1S/C14H17N5O2/c1-9-3-2-4-19(8-9)14(21)13(20)17-11-6-15-7-12-10(11)5-16-18-12/h5-7,9H,2-4,8H2,1H3,(H,16,18)(H,17,20) |
| InChIKey | FNSCHNZKJNHTCX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|