C27H43F3N4O3 — CID 169114169
2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6,7-dihydroindazole;2,2,2-trifluoroethyl 2-[ethyl(2-methylpropyl)amino]-2-oxoacetate (PubChem CID 169114169) has the molecular formula C27H43F3N4O3 and a molecular weight of 528.66 g/mol. Its IUPAC name is 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6,7-dihydroindazole;2,2,2-trifluoroethyl 2-[ethyl(2-methylpropyl)amino]-2-oxoacetate.
| Compound Name | 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6,7-dihydroindazole;2,2,2-trifluoroethyl 2-[ethyl(2-methylpropyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 169114169 |
| Molecular Formula | C27H43F3N4O3 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6,7-dihydroindazole;2,2,2-trifluoroethyl 2-[ethyl(2-methylpropyl)amino]-2-oxoacetate |
| SMILES | CCN(CC(C)C)C(=O)C(=O)OCC(F)(F)F.CN1C(C)(C)CC(n2cc3c(n2)CCC=C3)CC1(C)C |
| InChI | InChI=1S/C17H27N3.C10H16F3NO3/c1-16(2)10-14(11-17(3,4)19(16)5)20-12-13-8-6-7-9-15(13)18-20;1-4-14(5-7(2)3)8(15)9(16)17-6-10(11,12)13/h6,8,12,14H,7,9-11H2,1-5H3;7H,4-6H2,1-3H3 |
| InChIKey | MCEXXFGZZXIBKN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|