About (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine
(2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine (PubChem CID 169114344) has the molecular formula C12H19F2N
and a molecular weight of 215.29 g/mol. Its IUPAC name is (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine.
Molecular Properties
| Compound Name | (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine |
| PubChem CID | 169114344 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine |
| SMILES | C[C@H]1CC[C@H](C2=CCC(F)(F)CC2)NC1 |
| InChI | InChI=1S/C12H19F2N/c1-9-2-3-11(15-8-9)10-4-6-12(13,14)7-5-10/h4,9,11,15H,2-3,5-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | GKQOJCUJXQNOAZ-GXSJLCMTSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine?
The IUPAC name of (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine (CID 169114344) is (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine.
What is the SMILES notation for (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine?
The canonical SMILES for (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine is C[C@H]1CC[C@H](C2=CCC(F)(F)CC2)NC1.
What is the InChIKey of (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine?
The InChIKey is GKQOJCUJXQNOAZ-GXSJLCMTSA-N. The full InChI is InChI=1S/C12H19F2N/c1-9-2-3-11(15-8-9)10-4-6-12(13,14)7-5-10/h4,9,11,15H,2-3,5-8H2,1H3/t9-,11+/m0/s1.
What are the key properties of (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine?
(2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine has a molecular weight of 215.29 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2-(4,4-difluorocyclohexen-1-yl)-5-methylpiperidine is sourced from PubChem (CID 169114344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).