C22H41F3N2O4 — CID 169114383
N-ethyl-N-(2-methylpropyl)formamide;2-[(2E,4Z)-hepta-2,4-dien-3-yl]oxy-N,N-dimethylethanamine;2,2,2-trifluoroethyl acetate (PubChem CID 169114383) has the molecular formula C22H41F3N2O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-ethyl-N-(2-methylpropyl)formamide;2-[(2E,4Z)-hepta-2,4-dien-3-yl]oxy-N,N-dimethylethanamine;2,2,2-trifluoroethyl acetate.
| Compound Name | N-ethyl-N-(2-methylpropyl)formamide;2-[(2E,4Z)-hepta-2,4-dien-3-yl]oxy-N,N-dimethylethanamine;2,2,2-trifluoroethyl acetate |
|---|---|
| PubChem CID | 169114383 |
| Molecular Formula | C22H41F3N2O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | N-ethyl-N-(2-methylpropyl)formamide;2-[(2E,4Z)-hepta-2,4-dien-3-yl]oxy-N,N-dimethylethanamine;2,2,2-trifluoroethyl acetate |
| SMILES | C/C=C(\C=C/CC)OCCN(C)C.CC(=O)OCC(F)(F)F.CCN(C=O)CC(C)C |
| InChI | InChI=1S/C11H21NO.C7H15NO.C4H5F3O2/c1-5-7-8-11(6-2)13-10-9-12(3)4;1-4-8(6-9)5-7(2)3;1-3(8)9-2-4(5,6)7/h6-8H,5,9-10H2,1-4H3;6-7H,4-5H2,1-3H3;2H2,1H3/b8-7-,11-6+;; |
| InChIKey | BJXKCUPNSJNFGY-PLHWRCAFSA-N |
| XLogP | 4.67 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|