About ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate
ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate (PubChem CID 169114396) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate.
Molecular Properties
| Compound Name | ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate |
| PubChem CID | 169114396 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1\CCN(C)CC1C |
| InChI | InChI=1S/C11H19NO2/c1-4-14-11(13)7-10-5-6-12(3)8-9(10)2/h7,9H,4-6,8H2,1-3H3/b10-7+ |
| InChIKey | CIMDOGWZWYVIGW-JXMROGBWSA-N |
| XLogP | 1.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate?
The IUPAC name of ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate (CID 169114396) is ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate.
What is the SMILES notation for ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate?
The canonical SMILES for ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate is CCOC(=O)/C=C1\CCN(C)CC1C.
What is the InChIKey of ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate?
The InChIKey is CIMDOGWZWYVIGW-JXMROGBWSA-N. The full InChI is InChI=1S/C11H19NO2/c1-4-14-11(13)7-10-5-6-12(3)8-9(10)2/h7,9H,4-6,8H2,1-3H3/b10-7+.
What are the key properties of ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate?
ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate has a molecular weight of 197.28 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-2-(1,3-dimethylpiperidin-4-ylidene)acetate is sourced from PubChem (CID 169114396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).