About N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide
N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide (PubChem CID 169114715) has the molecular formula C16H23N5O2
and a molecular weight of 317.39 g/mol. Its IUPAC name is N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide.
Molecular Properties
| Compound Name | N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide |
| PubChem CID | 169114715 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide |
| SMILES | CCCC(C)CN(CC)C(=O)C(=O)Nc1cncc2cn[nH]c12 |
| InChI | InChI=1S/C16H23N5O2/c1-4-6-11(3)10-21(5-2)16(23)15(22)19-13-9-17-7-12-8-18-20-14(12)13/h7-9,11H,4-6,10H2,1-3H3,(H,18,20)(H,19,22) |
| InChIKey | GKGXHJVFULJPJU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide?
The IUPAC name of N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide (CID 169114715) is N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide.
What is the SMILES notation for N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide?
The canonical SMILES for N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide is CCCC(C)CN(CC)C(=O)C(=O)Nc1cncc2cn[nH]c12.
What is the InChIKey of N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide?
The InChIKey is GKGXHJVFULJPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O2/c1-4-6-11(3)10-21(5-2)16(23)15(22)19-13-9-17-7-12-8-18-20-14(12)13/h7-9,11H,4-6,10H2,1-3H3,(H,18,20)(H,19,22).
What are the key properties of N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide?
N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide has a molecular weight of 317.39 g/mol, XLogP of 2.18, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-(2-methylpentyl)-N-(1H-pyrazolo[4,3-c]pyridin-7-yl)oxamide is sourced from PubChem (CID 169114715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).