C12H18F3NO3 — CID 169114747
2,2,2-trifluoroethyl 2-[(2S,5S)-2-ethyl-5-methylpiperidin-1-yl]-2-oxoacetate (PubChem CID 169114747) has the molecular formula C12H18F3NO3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(2S,5S)-2-ethyl-5-methylpiperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(2S,5S)-2-ethyl-5-methylpiperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169114747 |
| Molecular Formula | C12H18F3NO3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(2S,5S)-2-ethyl-5-methylpiperidin-1-yl]-2-oxoacetate |
| SMILES | CC[C@H]1CC[C@H](C)CN1C(=O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C12H18F3NO3/c1-3-9-5-4-8(2)6-16(9)10(17)11(18)19-7-12(13,14)15/h8-9H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | WATMSPGKJIASFY-IUCAKERBSA-N |
| XLogP | 2.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|