About 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane
2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane (PubChem CID 169114840) has the molecular formula C12H19F3N2O2
and a molecular weight of 280.29 g/mol. Its IUPAC name is 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane.
Molecular Properties
| Compound Name | 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane |
| PubChem CID | 169114840 |
| Molecular Formula | C12H19F3N2O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane |
| SMILES | CC1CCCN(C(=O)C(N)=O)C1.FC(F)(F)C1CC1 |
| InChI | InChI=1S/C8H14N2O2.C4H5F3/c1-6-3-2-4-10(5-6)8(12)7(9)11;5-4(6,7)3-1-2-3/h6H,2-5H2,1H3,(H2,9,11);3H,1-2H2 |
| InChIKey | BKQWSXPNFHPADU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane?
The IUPAC name of 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane (CID 169114840) is 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane.
What is the SMILES notation for 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane?
The canonical SMILES for 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane is CC1CCCN(C(=O)C(N)=O)C1.FC(F)(F)C1CC1.
What is the InChIKey of 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane?
The InChIKey is BKQWSXPNFHPADU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2.C4H5F3/c1-6-3-2-4-10(5-6)8(12)7(9)11;5-4(6,7)3-1-2-3/h6H,2-5H2,1H3,(H2,9,11);3H,1-2H2.
What are the key properties of 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane?
2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane has a molecular weight of 280.29 g/mol, XLogP of 1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylpiperidin-1-yl)-2-oxoacetamide;trifluoromethylcyclopropane is sourced from PubChem (CID 169114840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).