C9H16O3 — CID 169116609
(3aR,6aR)-3-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 169116609) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (3aR,6aR)-3-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | (3aR,6aR)-3-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 169116609 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (3aR,6aR)-3-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | CC(C)C1CO[C@@H]2C(O)CO[C@H]12 |
| InChI | InChI=1S/C9H16O3/c1-5(2)6-3-11-9-7(10)4-12-8(6)9/h5-10H,3-4H2,1-2H3/t6?,7?,8-,9-/m1/s1 |
| InChIKey | HJQFEPFZOAKKCJ-GEPGNKONSA-N |
| XLogP | 0.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |