C20H21F4N5O2 — CID 169116927
(3S,4R)-4-[[5-fluoro-7-[5-(1,1,2-trifluoro-2-methylpropyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol (PubChem CID 169116927) has the molecular formula C20H21F4N5O2 and a molecular weight of 439.41 g/mol. Its IUPAC name is (3S,4R)-4-[[5-fluoro-7-[5-(1,1,2-trifluoro-2-methylpropyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol.
| Compound Name | (3S,4R)-4-[[5-fluoro-7-[5-(1,1,2-trifluoro-2-methylpropyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol |
|---|---|
| PubChem CID | 169116927 |
| Molecular Formula | C20H21F4N5O2 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (3S,4R)-4-[[5-fluoro-7-[5-(1,1,2-trifluoro-2-methylpropyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol |
| SMILES | CC(C)(F)C(F)(F)c1ccc(-c2cc(F)c3cnc(N[C@@H]4CCOC[C@H]4O)nn23)nc1 |
| InChI | InChI=1S/C20H21F4N5O2/c1-19(2,22)20(23,24)11-3-4-13(25-8-11)15-7-12(21)16-9-26-18(28-29(15)16)27-14-5-6-31-10-17(14)30/h3-4,7-9,14,17,30H,5-6,10H2,1-2H3,(H,27,28)/t14-,17-/m1/s1 |
| InChIKey | FKQVMAXAQVWTGF-RHSMWYFYSA-N |
| XLogP | 3.33 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |