C18H20F3N5O2 — CID 169116939
7-[1-(2,2-difluoroethyl)cyclobutyl]-5-fluoro-2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile (PubChem CID 169116939) has the molecular formula C18H20F3N5O2 and a molecular weight of 395.39 g/mol. Its IUPAC name is 7-[1-(2,2-difluoroethyl)cyclobutyl]-5-fluoro-2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile.
| Compound Name | 7-[1-(2,2-difluoroethyl)cyclobutyl]-5-fluoro-2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile |
|---|---|
| PubChem CID | 169116939 |
| Molecular Formula | C18H20F3N5O2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 7-[1-(2,2-difluoroethyl)cyclobutyl]-5-fluoro-2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile |
| SMILES | N#Cc1c(F)c2cnc(N[C@@H]3CCOC[C@H]3O)nn2c1C1(CC(F)F)CCC1 |
| InChI | InChI=1S/C18H20F3N5O2/c19-14(20)6-18(3-1-4-18)16-10(7-22)15(21)12-8-23-17(25-26(12)16)24-11-2-5-28-9-13(11)27/h8,11,13-14,27H,1-6,9H2,(H,24,25)/t11-,13-/m1/s1 |
| InChIKey | KUUYSYVHSVNNAX-DGCLKSJQSA-N |
| XLogP | 2.38 |
| TPSA | 95.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |