C17H26N4O2 — CID 169116968
7-(1-ethylcyclobutyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine;oxan-3-ol (PubChem CID 169116968) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 7-(1-ethylcyclobutyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine;oxan-3-ol.
| Compound Name | 7-(1-ethylcyclobutyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine;oxan-3-ol |
|---|---|
| PubChem CID | 169116968 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 7-(1-ethylcyclobutyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine;oxan-3-ol |
| SMILES | CCC1(c2ccc3cnc(N)nn23)CCC1.OC1CCCOC1 |
| InChI | InChI=1S/C12H16N4.C5H10O2/c1-2-12(6-3-7-12)10-5-4-9-8-14-11(13)15-16(9)10;6-5-2-1-3-7-4-5/h4-5,8H,2-3,6-7H2,1H3,(H2,13,15);5-6H,1-4H2 |
| InChIKey | BRAJBUYRODAIFP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |