C11H11FN4 — CID 169116971
7-(1-ethenylcyclopropyl)-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 169116971) has the molecular formula C11H11FN4 and a molecular weight of 218.23 g/mol. Its IUPAC name is 7-(1-ethenylcyclopropyl)-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 7-(1-ethenylcyclopropyl)-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 169116971 |
| Molecular Formula | C11H11FN4 |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 7-(1-ethenylcyclopropyl)-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | C=CC1(c2cc(F)c3cnc(N)nn23)CC1 |
| InChI | InChI=1S/C11H11FN4/c1-2-11(3-4-11)9-5-7(12)8-6-14-10(13)15-16(8)9/h2,5-6H,1,3-4H2,(H2,13,15) |
| InChIKey | ZDPRMAKBWBOHDP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|