C21H24FN5O2 — CID 169117050
(3S,4R)-4-[[7-[5-(2,2-dimethylcyclopropyl)-2-pyridinyl]-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol (PubChem CID 169117050) has the molecular formula C21H24FN5O2 and a molecular weight of 397.45 g/mol. Its IUPAC name is (3S,4R)-4-[[7-[5-(2,2-dimethylcyclopropyl)-2-pyridinyl]-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol.
| Compound Name | (3S,4R)-4-[[7-[5-(2,2-dimethylcyclopropyl)-2-pyridinyl]-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol |
|---|---|
| PubChem CID | 169117050 |
| Molecular Formula | C21H24FN5O2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (3S,4R)-4-[[7-[5-(2,2-dimethylcyclopropyl)-2-pyridinyl]-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol |
| SMILES | CC1(C)CC1c1ccc(-c2cc(F)c3cnc(N[C@@H]4CCOC[C@H]4O)nn23)nc1 |
| InChI | InChI=1S/C21H24FN5O2/c1-21(2)8-13(21)12-3-4-15(23-9-12)17-7-14(22)18-10-24-20(26-27(17)18)25-16-5-6-29-11-19(16)28/h3-4,7,9-10,13,16,19,28H,5-6,8,11H2,1-2H3,(H,25,26)/t13?,16-,19-/m1/s1 |
| InChIKey | IVIJSLVGNZFRRV-FDMCOVCTSA-N |
| XLogP | 3.01 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |