C19H19F3N6O2 — CID 169117092
2,2,2-trifluoro-1-[(3R,4R)-3-hydroxy-4-[[7-(5-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone (PubChem CID 169117092) has the molecular formula C19H19F3N6O2 and a molecular weight of 420.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(3R,4R)-3-hydroxy-4-[[7-(5-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(3R,4R)-3-hydroxy-4-[[7-(5-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 169117092 |
| Molecular Formula | C19H19F3N6O2 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2,2,2-trifluoro-1-[(3R,4R)-3-hydroxy-4-[[7-(5-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone |
| SMILES | Cc1ccc(-c2ccc3cnc(N[C@@H]4CCN(C(=O)C(F)(F)F)C[C@H]4O)nn23)nc1 |
| InChI | InChI=1S/C19H19F3N6O2/c1-11-2-4-13(23-8-11)15-5-3-12-9-24-18(26-28(12)15)25-14-6-7-27(10-16(14)29)17(30)19(20,21)22/h2-5,8-9,14,16,29H,6-7,10H2,1H3,(H,25,26)/t14-,16-/m1/s1 |
| InChIKey | VDVXRTKWJIEUFW-GDBMZVCRSA-N |
| XLogP | 2.04 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |