C14H19N5O3 — CID 169117148
2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]-N,N-dimethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 169117148) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]-N,N-dimethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]-N,N-dimethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 169117148 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]-N,N-dimethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cnc(N[C@@H]3CCOC[C@H]3O)nn2c1 |
| InChI | InChI=1S/C14H19N5O3/c1-18(2)13(21)9-5-10-6-15-14(17-19(10)7-9)16-11-3-4-22-8-12(11)20/h5-7,11-12,20H,3-4,8H2,1-2H3,(H,16,17)/t11-,12-/m1/s1 |
| InChIKey | LMZUKYXTAPQVDB-VXGBXAGGSA-N |
| XLogP | -0.01 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |