C17H18ClF2N5OS — CID 169117343
7-(4-chloro-2-fluorophenyl)-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-amine;1-sulfanylpiperidin-3-ol (PubChem CID 169117343) has the molecular formula C17H18ClF2N5OS and a molecular weight of 413.88 g/mol. Its IUPAC name is 7-(4-chloro-2-fluorophenyl)-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-amine;1-sulfanylpiperidin-3-ol.
| Compound Name | 7-(4-chloro-2-fluorophenyl)-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-amine;1-sulfanylpiperidin-3-ol |
|---|---|
| PubChem CID | 169117343 |
| Molecular Formula | C17H18ClF2N5OS |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 7-(4-chloro-2-fluorophenyl)-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-amine;1-sulfanylpiperidin-3-ol |
| SMILES | Nc1ncc2c(F)cc(-c3ccc(Cl)cc3F)n2n1.OC1CCCN(S)C1 |
| InChI | InChI=1S/C12H7ClF2N4.C5H11NOS/c13-6-1-2-7(8(14)3-6)10-4-9(15)11-5-17-12(16)18-19(10)11;7-5-2-1-3-6(8)4-5/h1-5H,(H2,16,18);5,7-8H,1-4H2 |
| InChIKey | BZCWEDFOZDSATF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|