C14H12F4N6O2S — CID 169117758
(3S,4R)-4-[[5-fluoro-7-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol (PubChem CID 169117758) has the molecular formula C14H12F4N6O2S and a molecular weight of 404.35 g/mol. Its IUPAC name is (3S,4R)-4-[[5-fluoro-7-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol.
| Compound Name | (3S,4R)-4-[[5-fluoro-7-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol |
|---|---|
| PubChem CID | 169117758 |
| Molecular Formula | C14H12F4N6O2S |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | (3S,4R)-4-[[5-fluoro-7-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol |
| SMILES | O[C@@H]1COCC[C@H]1Nc1ncc2c(F)cc(-c3nnc(C(F)(F)F)s3)n2n1 |
| InChI | InChI=1S/C14H12F4N6O2S/c15-6-3-8(11-21-22-12(27-11)14(16,17)18)24-9(6)4-19-13(23-24)20-7-1-2-26-5-10(7)25/h3-4,7,10,25H,1-2,5H2,(H,20,23)/t7-,10-/m1/s1 |
| InChIKey | FHRXQRGKKCMVHS-GMSGAONNSA-N |
| XLogP | 1.97 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |