C15H17BrF5N5O2S — CID 169117774
6-bromo-5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]-7-[(2S)-1,1,1-trifluoropropan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 169117774) has the molecular formula C15H17BrF5N5O2S and a molecular weight of 506.30 g/mol. Its IUPAC name is 6-bromo-5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]-7-[(2S)-1,1,1-trifluoropropan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 6-bromo-5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]-7-[(2S)-1,1,1-trifluoropropan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 169117774 |
| Molecular Formula | C15H17BrF5N5O2S |
| Molecular Weight | 506.30 g/mol |
| Exact Mass | 505.02 |
| IUPAC Name | 6-bromo-5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]-7-[(2S)-1,1,1-trifluoropropan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | C[C@@H](c1c(Br)c(F)c2cnc(N[C@@H]3CCN(S(C)(=O)=O)C[C@H]3F)nn12)C(F)(F)F |
| InChI | InChI=1S/C15H17BrF5N5O2S/c1-7(15(19,20)21)13-11(16)12(18)10-5-22-14(24-26(10)13)23-9-3-4-25(6-8(9)17)29(2,27)28/h5,7-9H,3-4,6H2,1-2H3,(H,23,24)/t7-,8+,9+/m0/s1 |
| InChIKey | ODYBXEUTNQQEJO-DJLDLDEBSA-N |
| XLogP | 3.08 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |