C17H19N9O3S — CID 169117867
(3R,4R)-1-methylsulfonyl-4-[[7-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol (PubChem CID 169117867) has the molecular formula C17H19N9O3S and a molecular weight of 429.47 g/mol. Its IUPAC name is (3R,4R)-1-methylsulfonyl-4-[[7-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol.
| Compound Name | (3R,4R)-1-methylsulfonyl-4-[[7-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol |
|---|---|
| PubChem CID | 169117867 |
| Molecular Formula | C17H19N9O3S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (3R,4R)-1-methylsulfonyl-4-[[7-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol |
| SMILES | CS(=O)(=O)N1CC[C@@H](Nc2ncc3ccc(-c4cncc5nncn45)n3n2)[C@H](O)C1 |
| InChI | InChI=1S/C17H19N9O3S/c1-30(28,29)24-5-4-12(15(27)9-24)21-17-19-6-11-2-3-13(26(11)23-17)14-7-18-8-16-22-20-10-25(14)16/h2-3,6-8,10,12,15,27H,4-5,9H2,1H3,(H,21,23)/t12-,15-/m1/s1 |
| InChIKey | MPFTZLNDLFCPTD-IUODEOHRSA-N |
| XLogP | -0.36 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |