C9H11FN4 — CID 169118083
5-fluoro-7-propylpyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 169118083) has the molecular formula C9H11FN4 and a molecular weight of 194.21 g/mol. Its IUPAC name is 5-fluoro-7-propylpyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-fluoro-7-propylpyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 169118083 |
| Molecular Formula | C9H11FN4 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 5-fluoro-7-propylpyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CCCc1cc(F)c2cnc(N)nn12 |
| InChI | InChI=1S/C9H11FN4/c1-2-3-6-4-7(10)8-5-12-9(11)13-14(6)8/h4-5H,2-3H2,1H3,(H2,11,13) |
| InChIKey | NWNVYJFBAHRVJU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |