About 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one
2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one (PubChem CID 169118413) has the molecular formula C15H16BrFN2O
and a molecular weight of 339.21 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one.
Molecular Properties
| Compound Name | 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one |
| PubChem CID | 169118413 |
| Molecular Formula | C15H16BrFN2O |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one |
| SMILES | C[C@H](N)[C@@H]1C[C@H]1Cn1ccc2cc(Br)c(F)cc2c1=O |
| InChI | InChI=1S/C15H16BrFN2O/c1-8(18)11-4-10(11)7-19-3-2-9-5-13(16)14(17)6-12(9)15(19)20/h2-3,5-6,8,10-11H,4,7,18H2,1H3/t8-,10-,11-/m0/s1 |
| InChIKey | TVEMISORVAQVTQ-LSJOCFKGSA-N |
| XLogP | 2.89 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one?
The IUPAC name of 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one (CID 169118413) is 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one.
What is the SMILES notation for 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one?
The canonical SMILES for 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one is C[C@H](N)[C@@H]1C[C@H]1Cn1ccc2cc(Br)c(F)cc2c1=O.
What is the InChIKey of 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one?
The InChIKey is TVEMISORVAQVTQ-LSJOCFKGSA-N. The full InChI is InChI=1S/C15H16BrFN2O/c1-8(18)11-4-10(11)7-19-3-2-9-5-13(16)14(17)6-12(9)15(19)20/h2-3,5-6,8,10-11H,4,7,18H2,1H3/t8-,10-,11-/m0/s1.
What are the key properties of 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one?
2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one has a molecular weight of 339.21 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1R,2R)-2-[(1S)-1-aminoethyl]cyclopropyl]methyl]-6-bromo-7-fluoroisoquinolin-1-one is sourced from PubChem (CID 169118413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).