C20H21FN4O2 — CID 169118547
6-(4-amino-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)-7-fluoro-2-pentylisoquinolin-1-one (PubChem CID 169118547) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is 6-(4-amino-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)-7-fluoro-2-pentylisoquinolin-1-one.
| Compound Name | 6-(4-amino-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)-7-fluoro-2-pentylisoquinolin-1-one |
|---|---|
| PubChem CID | 169118547 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 6-(4-amino-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)-7-fluoro-2-pentylisoquinolin-1-one |
| SMILES | CCCCCn1ccc2cc(-c3nc(N)c4c(n3)COC4)c(F)cc2c1=O |
| InChI | InChI=1S/C20H21FN4O2/c1-2-3-4-6-25-7-5-12-8-14(16(21)9-13(12)20(25)26)19-23-17-11-27-10-15(17)18(22)24-19/h5,7-9H,2-4,6,10-11H2,1H3,(H2,22,23,24) |
| InChIKey | MKUCICUZVMQTEY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|