About CID 169118747
CID 169118747 (PubChem CID 169118747) has the molecular formula C24H22BF4N7O5
and a molecular weight of 575.29 g/mol.
Molecular Properties
| Compound Name | CID 169118747 |
| PubChem CID | 169118747 |
| Molecular Formula | C24H22BF4N7O5 |
| Molecular Weight | 575.29 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)Oc1cnc(-c2cc3ccn(CCC[C@H](C)Nc4cn[nH]c(=O)c4C(F)(F)F)c(=O)c3cc2F)nc1N |
| InChI | InChI=1S/C24H22BF4N7O5/c1-11(33-16-9-32-35-21(37)18(16)23(27,28)29)3-2-5-36-6-4-12-7-14(15(26)8-13(12)22(36)38)20-31-10-17(19(30)34-20)41-24(25,39)40/h4,6-11,39-40H,2-3,5H2,1H3,(H2,30,31,34)(H2,33,35,37)/t11-/m0/s1 |
| InChIKey | SHLFJINRNSUSBK-NSHDSACASA-N |
| XLogP | 1.71 |
| TPSA | 181.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 575.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 169118747 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169118747?
The IUPAC name of CID 169118747 (CID 169118747) is not available.
What is the SMILES notation for CID 169118747?
The canonical SMILES for CID 169118747 is [B]C(O)(O)Oc1cnc(-c2cc3ccn(CCC[C@H](C)Nc4cn[nH]c(=O)c4C(F)(F)F)c(=O)c3cc2F)nc1N.
What is the InChIKey of CID 169118747?
The InChIKey is SHLFJINRNSUSBK-NSHDSACASA-N. The full InChI is InChI=1S/C24H22BF4N7O5/c1-11(33-16-9-32-35-21(37)18(16)23(27,28)29)3-2-5-36-6-4-12-7-14(15(26)8-13(12)22(36)38)20-31-10-17(19(30)34-20)41-24(25,39)40/h4,6-11,39-40H,2-3,5H2,1H3,(H2,30,31,34)(H2,33,35,37)/t11-/m0/s1.
What are the key properties of CID 169118747?
CID 169118747 has a molecular weight of 575.29 g/mol, XLogP of 1.71, 9 rotatable bonds, 5 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169118747 is sourced from PubChem (CID 169118747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).