About 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine
1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine (PubChem CID 169119296) has the molecular formula C19H33F2NO4S
and a molecular weight of 409.54 g/mol. Its IUPAC name is 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine.
Molecular Properties
| Compound Name | 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine |
| PubChem CID | 169119296 |
| Molecular Formula | C19H33F2NO4S |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine |
| SMILES | CC(C)(C)N.Cc1ccc(SOCCCCCCOC(F)F)cc1.O=CO |
| InChI | InChI=1S/C14H20F2O2S.C4H11N.CH2O2/c1-12-6-8-13(9-7-12)19-18-11-5-3-2-4-10-17-14(15)16;1-4(2,3)5;2-1-3/h6-9,14H,2-5,10-11H2,1H3;5H2,1-3H3;1H,(H,2,3) |
| InChIKey | VPBBWNUMILQLTM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine?
The IUPAC name of 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine (CID 169119296) is 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine.
What is the SMILES notation for 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine?
The canonical SMILES for 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine is CC(C)(C)N.Cc1ccc(SOCCCCCCOC(F)F)cc1.O=CO.
What is the InChIKey of 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine?
The InChIKey is VPBBWNUMILQLTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2O2S.C4H11N.CH2O2/c1-12-6-8-13(9-7-12)19-18-11-5-3-2-4-10-17-14(15)16;1-4(2,3)5;2-1-3/h6-9,14H,2-5,10-11H2,1H3;5H2,1-3H3;1H,(H,2,3).
What are the key properties of 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine?
1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine has a molecular weight of 409.54 g/mol, XLogP of 5.26, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(difluoromethoxy)hexoxysulfanyl]-4-methylbenzene;formic acid;2-methylpropan-2-amine is sourced from PubChem (CID 169119296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).