About [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite
[4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite (PubChem CID 169119643) has the molecular formula C9H11FN4S
and a molecular weight of 226.28 g/mol. Its IUPAC name is [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite |
| PubChem CID | 169119643 |
| Molecular Formula | C9H11FN4S |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite |
| SMILES | CNCc1cnc(C)c2cnn(SF)c12 |
| InChI | InChI=1S/C9H11FN4S/c1-6-8-5-13-14(15-10)9(8)7(3-11-2)4-12-6/h4-5,11H,3H2,1-2H3 |
| InChIKey | KODPTWFSDRMOKY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite?
The IUPAC name of [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite (CID 169119643) is [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite.
What is the SMILES notation for [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite?
The canonical SMILES for [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite is CNCc1cnc(C)c2cnn(SF)c12.
What is the InChIKey of [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite?
The InChIKey is KODPTWFSDRMOKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN4S/c1-6-8-5-13-14(15-10)9(8)7(3-11-2)4-12-6/h4-5,11H,3H2,1-2H3.
What are the key properties of [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite?
[4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite has a molecular weight of 226.28 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-7-(methylaminomethyl)pyrazolo[4,5-c]pyridin-1-yl] thiohypofluorite is sourced from PubChem (CID 169119643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).