C17H23ClN2O3S — CID 169122016
4-chloro-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-pent-4-en-2-ylbenzamide (PubChem CID 169122016) has the molecular formula C17H23ClN2O3S and a molecular weight of 370.90 g/mol. Its IUPAC name is 4-chloro-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-pent-4-en-2-ylbenzamide.
| Compound Name | 4-chloro-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-pent-4-en-2-ylbenzamide |
|---|---|
| PubChem CID | 169122016 |
| Molecular Formula | C17H23ClN2O3S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-chloro-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-pent-4-en-2-ylbenzamide |
| SMILES | C=CCC(C)NC(=O)c1ccc(Cl)c(CN2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C17H23ClN2O3S/c1-3-4-13(2)19-17(21)14-5-6-16(18)15(11-14)12-20-7-9-24(22,23)10-8-20/h3,5-6,11,13H,1,4,7-10,12H2,2H3,(H,19,21) |
| InChIKey | FCHZCNSGTWVDAG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|