About ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine
ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine (PubChem CID 169122748) has the molecular formula C17H34N4
and a molecular weight of 294.49 g/mol. Its IUPAC name is ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine.
Molecular Properties
| Compound Name | ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine |
| PubChem CID | 169122748 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine |
| SMILES | CC.CCNc1cc(N(C)C)ccn1.CN1CCCCC1 |
| InChI | InChI=1S/C9H15N3.C6H13N.C2H6/c1-4-10-9-7-8(12(2)3)5-6-11-9;1-7-5-3-2-4-6-7;1-2/h5-7H,4H2,1-3H3,(H,10,11);2-6H2,1H3;1-2H3 |
| InChIKey | BCTXGAXEZNFLHX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine?
The IUPAC name of ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine (CID 169122748) is ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine.
What is the SMILES notation for ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine?
The canonical SMILES for ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine is CC.CCNc1cc(N(C)C)ccn1.CN1CCCCC1.
What is the InChIKey of ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine?
The InChIKey is BCTXGAXEZNFLHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3.C6H13N.C2H6/c1-4-10-9-7-8(12(2)3)5-6-11-9;1-7-5-3-2-4-6-7;1-2/h5-7H,4H2,1-3H3,(H,10,11);2-6H2,1H3;1-2H3.
What are the key properties of ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine?
ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine has a molecular weight of 294.49 g/mol, XLogP of 3.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-N-ethyl-4-N,4-N-dimethylpyridine-2,4-diamine;1-methylpiperidine is sourced from PubChem (CID 169122748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).