About (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine
(1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine (PubChem CID 169122753) has the molecular formula C16H34N4
and a molecular weight of 282.48 g/mol. Its IUPAC name is (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine.
Molecular Properties
| Compound Name | (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine |
| PubChem CID | 169122753 |
| Molecular Formula | C16H34N4 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.28 |
| IUPAC Name | (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine |
| SMILES | C=C/C(C)=N\C(=N\C)NCC.CC.CN1CCCCC1 |
| InChI | InChI=1S/C8H15N3.C6H13N.C2H6/c1-5-7(3)11-8(9-4)10-6-2;1-7-5-3-2-4-6-7;1-2/h5H,1,6H2,2-4H3,(H,9,10);2-6H2,1H3;1-2H3/b11-7-;; |
| InChIKey | UFQRZSSLYJRQBO-FJJKMGSJSA-N |
| XLogP | 3.36 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine?
The IUPAC name of (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine (CID 169122753) is (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine.
What is the SMILES notation for (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine?
The canonical SMILES for (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine is C=C/C(C)=N\C(=N\C)NCC.CC.CN1CCCCC1.
What is the InChIKey of (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine?
The InChIKey is UFQRZSSLYJRQBO-FJJKMGSJSA-N. The full InChI is InChI=1S/C8H15N3.C6H13N.C2H6/c1-5-7(3)11-8(9-4)10-6-2;1-7-5-3-2-4-6-7;1-2/h5H,1,6H2,2-4H3,(H,9,10);2-6H2,1H3;1-2H3/b11-7-;;.
What are the key properties of (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine?
(1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine has a molecular weight of 282.48 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-but-3-en-2-ylidene-3-ethyl-2-methylguanidine;ethane;1-methylpiperidine is sourced from PubChem (CID 169122753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).