About ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine
ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine (PubChem CID 169123370) has the molecular formula C19H35FN2
and a molecular weight of 310.50 g/mol. Its IUPAC name is ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine |
| PubChem CID | 169123370 |
| Molecular Formula | C19H35FN2 |
| Molecular Weight | 310.50 g/mol |
| Exact Mass | 310.28 |
| IUPAC Name | ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine |
| SMILES | CC.CC.Cc1cc(F)ccc1N(C)C1CCN(C)CC1C |
| InChI | InChI=1S/C15H23FN2.2C2H6/c1-11-9-13(16)5-6-14(11)18(4)15-7-8-17(3)10-12(15)2;2*1-2/h5-6,9,12,15H,7-8,10H2,1-4H3;2*1-2H3 |
| InChIKey | HSDJWEDJJPGXJA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine?
The IUPAC name of ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine (CID 169123370) is ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine.
What is the SMILES notation for ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine?
The canonical SMILES for ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine is CC.CC.Cc1cc(F)ccc1N(C)C1CCN(C)CC1C.
What is the InChIKey of ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine?
The InChIKey is HSDJWEDJJPGXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23FN2.2C2H6/c1-11-9-13(16)5-6-14(11)18(4)15-7-8-17(3)10-12(15)2;2*1-2/h5-6,9,12,15H,7-8,10H2,1-4H3;2*1-2H3.
What are the key properties of ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine?
ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine has a molecular weight of 310.50 g/mol, XLogP of 4.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(4-fluoro-2-methylphenyl)-N,1,3-trimethylpiperidin-4-amine is sourced from PubChem (CID 169123370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).