C14H19FN2 — CID 169123401
(3S,3aS,6aS)-5-[(4-fluorophenyl)methyl]-3-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 169123401) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is (3S,3aS,6aS)-5-[(4-fluorophenyl)methyl]-3-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3S,3aS,6aS)-5-[(4-fluorophenyl)methyl]-3-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 169123401 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (3S,3aS,6aS)-5-[(4-fluorophenyl)methyl]-3-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | C[C@@H]1NC[C@H]2CN(Cc3ccc(F)cc3)C[C@H]21 |
| InChI | InChI=1S/C14H19FN2/c1-10-14-9-17(8-12(14)6-16-10)7-11-2-4-13(15)5-3-11/h2-5,10,12,14,16H,6-9H2,1H3/t10-,12-,14-/m0/s1 |
| InChIKey | IGPZFKMEANNTTO-JKOKRWQUSA-N |
| XLogP | 1.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |