About [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate
[[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate (PubChem CID 169123878) has the molecular formula C15H17F5N4O3
and a molecular weight of 396.32 g/mol. Its IUPAC name is [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate.
Molecular Properties
| Compound Name | [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate |
| PubChem CID | 169123878 |
| Molecular Formula | C15H17F5N4O3 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate |
| SMILES | Cc1c(C(F)(F)F)cnc(N2CCCC(F)(F)CC2)c1C(=O)NOC(N)=O |
| InChI | InChI=1S/C15H17F5N4O3/c1-8-9(15(18,19)20)7-22-11(10(8)12(25)23-27-13(21)26)24-5-2-3-14(16,17)4-6-24/h7H,2-6H2,1H3,(H2,21,26)(H,23,25) |
| InChIKey | JEMJIMZWDUJXJB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate?
The IUPAC name of [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate (CID 169123878) is [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate.
What is the SMILES notation for [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate?
The canonical SMILES for [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate is Cc1c(C(F)(F)F)cnc(N2CCCC(F)(F)CC2)c1C(=O)NOC(N)=O.
What is the InChIKey of [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate?
The InChIKey is JEMJIMZWDUJXJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F5N4O3/c1-8-9(15(18,19)20)7-22-11(10(8)12(25)23-27-13(21)26)24-5-2-3-14(16,17)4-6-24/h7H,2-6H2,1H3,(H2,21,26)(H,23,25).
What are the key properties of [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate?
[[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate has a molecular weight of 396.32 g/mol, XLogP of 2.77, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(4,4-difluoroazepan-1-yl)-4-methyl-5-(trifluoromethyl)pyridine-3-carbonyl]amino] carbamate is sourced from PubChem (CID 169123878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).