About 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine
3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine (PubChem CID 169124247) has the molecular formula C14H14F2N2
and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine.
Molecular Properties
| Compound Name | 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine |
| PubChem CID | 169124247 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine |
| SMILES | Cc1nnc(-c2ccc(C(F)F)cc2)c(C)c1C |
| InChI | InChI=1S/C14H14F2N2/c1-8-9(2)13(18-17-10(8)3)11-4-6-12(7-5-11)14(15)16/h4-7,14H,1-3H3 |
| InChIKey | XIPZVHJRCONQKT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine?
The IUPAC name of 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine (CID 169124247) is 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine.
What is the SMILES notation for 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine?
The canonical SMILES for 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine is Cc1nnc(-c2ccc(C(F)F)cc2)c(C)c1C.
What is the InChIKey of 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine?
The InChIKey is XIPZVHJRCONQKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N2/c1-8-9(2)13(18-17-10(8)3)11-4-6-12(7-5-11)14(15)16/h4-7,14H,1-3H3.
What are the key properties of 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine?
3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine has a molecular weight of 248.28 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine is sourced from PubChem (CID 169124247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).