About 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane
1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane (PubChem CID 169124345) has the molecular formula C8H18N2O2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane.
Molecular Properties
| Compound Name | 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane |
| PubChem CID | 169124345 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane |
| SMILES | CC.CS(C)(=O)=NC(=O)C1(N)CC1 |
| InChI | InChI=1S/C6H12N2O2S.C2H6/c1-11(2,10)8-5(9)6(7)3-4-6;1-2/h3-4,7H2,1-2H3;1-2H3 |
| InChIKey | ZDJDGKVOAQGPGQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane?
The IUPAC name of 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane (CID 169124345) is 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane.
What is the SMILES notation for 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane?
The canonical SMILES for 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane is CC.CS(C)(=O)=NC(=O)C1(N)CC1.
What is the InChIKey of 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane?
The InChIKey is ZDJDGKVOAQGPGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2S.C2H6/c1-11(2,10)8-5(9)6(7)3-4-6;1-2/h3-4,7H2,1-2H3;1-2H3.
What are the key properties of 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane?
1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane has a molecular weight of 206.31 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]cyclopropane-1-carboxamide;ethane is sourced from PubChem (CID 169124345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).