About 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid
2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 169124374) has the molecular formula C15H17F5N2O2
and a molecular weight of 352.30 g/mol. Its IUPAC name is 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid |
| PubChem CID | 169124374 |
| Molecular Formula | C15H17F5N2O2 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | Cc1nc(N2CCCC(F)(F)CC2)c(C(=O)O)c(C)c1C(F)(F)F |
| InChI | InChI=1S/C15H17F5N2O2/c1-8-10(13(23)24)12(21-9(2)11(8)15(18,19)20)22-6-3-4-14(16,17)5-7-22/h3-7H2,1-2H3,(H,23,24) |
| InChIKey | ATMMKSSGLSBIJV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid?
The IUPAC name of 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid (CID 169124374) is 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid.
What is the SMILES notation for 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid?
The canonical SMILES for 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid is Cc1nc(N2CCCC(F)(F)CC2)c(C(=O)O)c(C)c1C(F)(F)F.
What is the InChIKey of 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid?
The InChIKey is ATMMKSSGLSBIJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F5N2O2/c1-8-10(13(23)24)12(21-9(2)11(8)15(18,19)20)22-6-3-4-14(16,17)5-7-22/h3-7H2,1-2H3,(H,23,24).
What are the key properties of 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid?
2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid has a molecular weight of 352.30 g/mol, XLogP of 4.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoroazepan-1-yl)-4,6-dimethyl-5-(trifluoromethyl)pyridine-3-carboxylic acid is sourced from PubChem (CID 169124374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).