C14H13F3N4O2S — CID 169124466
5-methyl-N-[3-(methylsulfonimidoyl)phenyl]-6-(trifluoromethyl)pyridazine-4-carboxamide (PubChem CID 169124466) has the molecular formula C14H13F3N4O2S and a molecular weight of 358.35 g/mol. Its IUPAC name is 5-methyl-N-[3-(methylsulfonimidoyl)phenyl]-6-(trifluoromethyl)pyridazine-4-carboxamide.
| Compound Name | 5-methyl-N-[3-(methylsulfonimidoyl)phenyl]-6-(trifluoromethyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 169124466 |
| Molecular Formula | C14H13F3N4O2S |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 5-methyl-N-[3-(methylsulfonimidoyl)phenyl]-6-(trifluoromethyl)pyridazine-4-carboxamide |
| SMILES | [H]N=S(C)(=O)c1cccc(NC(=O)c2cnnc(C(F)(F)F)c2C)c1 |
| InChI | InChI=1S/C14H13F3N4O2S/c1-8-11(7-19-21-12(8)14(15,16)17)13(22)20-9-4-3-5-10(6-9)24(2,18)23/h3-7,18H,1-2H3,(H,20,22) |
| InChIKey | AITCCHVCYAEVBJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |