About N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide
N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide (PubChem CID 169124591) has the molecular formula C19H30N4O
and a molecular weight of 330.48 g/mol. Its IUPAC name is N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide |
| PubChem CID | 169124591 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide |
| SMILES | C/C=C(\C)NC(=O)c1c(N2CCCC(C)(C)CC2)nnc(C)c1C |
| InChI | InChI=1S/C19H30N4O/c1-7-13(2)20-18(24)16-14(3)15(4)21-22-17(16)23-11-8-9-19(5,6)10-12-23/h7H,8-12H2,1-6H3,(H,20,24)/b13-7+ |
| InChIKey | VHBIRJWRPKAYOQ-NTUHNPAUSA-N |
| XLogP | 3.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide?
The IUPAC name of N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide (CID 169124591) is N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide.
What is the SMILES notation for N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide?
The canonical SMILES for N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide is C/C=C(\C)NC(=O)c1c(N2CCCC(C)(C)CC2)nnc(C)c1C.
What is the InChIKey of N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide?
The InChIKey is VHBIRJWRPKAYOQ-NTUHNPAUSA-N. The full InChI is InChI=1S/C19H30N4O/c1-7-13(2)20-18(24)16-14(3)15(4)21-22-17(16)23-11-8-9-19(5,6)10-12-23/h7H,8-12H2,1-6H3,(H,20,24)/b13-7+.
What are the key properties of N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide?
N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide has a molecular weight of 330.48 g/mol, XLogP of 3.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-en-2-yl]-3-(4,4-dimethylazepan-1-yl)-5,6-dimethylpyridazine-4-carboxamide is sourced from PubChem (CID 169124591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).