About 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane
3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane (PubChem CID 169124848) has the molecular formula C22H38F2N2
and a molecular weight of 368.56 g/mol. Its IUPAC name is 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane.
Molecular Properties
| Compound Name | 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane |
| PubChem CID | 169124848 |
| Molecular Formula | C22H38F2N2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.30 |
| IUPAC Name | 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane |
| SMILES | CC.CC.CC.CC.Cc1nnc(-c2ccc(C(F)F)cc2)c(C)c1C |
| InChI | InChI=1S/C14H14F2N2.4C2H6/c1-8-9(2)13(18-17-10(8)3)11-4-6-12(7-5-11)14(15)16;4*1-2/h4-7,14H,1-3H3;4*1-2H3 |
| InChIKey | DVLJRAQEJYYNDK-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane?
The IUPAC name of 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane (CID 169124848) is 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane.
What is the SMILES notation for 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane?
The canonical SMILES for 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane is CC.CC.CC.CC.Cc1nnc(-c2ccc(C(F)F)cc2)c(C)c1C.
What is the InChIKey of 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane?
The InChIKey is DVLJRAQEJYYNDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N2.4C2H6/c1-8-9(2)13(18-17-10(8)3)11-4-6-12(7-5-11)14(15)16;4*1-2/h4-7,14H,1-3H3;4*1-2H3.
What are the key properties of 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane?
3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane has a molecular weight of 368.56 g/mol, XLogP of 8.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(difluoromethyl)phenyl]-4,5,6-trimethylpyridazine;ethane is sourced from PubChem (CID 169124848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).