About (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane
(5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane (PubChem CID 169125835) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane.
Molecular Properties
| Compound Name | (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane |
| PubChem CID | 169125835 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane |
| SMILES | C[C@H]1CC[C@@]2(CCCN2C)C1 |
| InChI | InChI=1S/C10H19N/c1-9-4-6-10(8-9)5-3-7-11(10)2/h9H,3-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | BQYBKFMHZIWGEN-UWVGGRQHSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane?
The IUPAC name of (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane (CID 169125835) is (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane.
What is the SMILES notation for (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane?
The canonical SMILES for (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane is C[C@H]1CC[C@@]2(CCCN2C)C1.
What is the InChIKey of (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane?
The InChIKey is BQYBKFMHZIWGEN-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H19N/c1-9-4-6-10(8-9)5-3-7-11(10)2/h9H,3-8H2,1-2H3/t9-,10-/m0/s1.
What are the key properties of (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane?
(5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane has a molecular weight of 153.27 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,8S)-1,8-dimethyl-1-azaspiro[4.4]nonane is sourced from PubChem (CID 169125835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).