C19H27N3O3 — CID 169125863
(7S)-7-ethyl-N-hydroxy-6-(7-oxaspiro[3.5]nonan-2-yl)-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide (PubChem CID 169125863) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (7S)-7-ethyl-N-hydroxy-6-(7-oxaspiro[3.5]nonan-2-yl)-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide.
| Compound Name | (7S)-7-ethyl-N-hydroxy-6-(7-oxaspiro[3.5]nonan-2-yl)-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 169125863 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (7S)-7-ethyl-N-hydroxy-6-(7-oxaspiro[3.5]nonan-2-yl)-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide |
| SMILES | CC[C@H]1Cc2ncc(C(=O)NO)cc2CN1C1CC2(CCOCC2)C1 |
| InChI | InChI=1S/C19H27N3O3/c1-2-15-8-17-14(7-13(11-20-17)18(23)21-24)12-22(15)16-9-19(10-16)3-5-25-6-4-19/h7,11,15-16,24H,2-6,8-10,12H2,1H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | GUFMCPIZPQIGPS-HNNXBMFYSA-N |
| XLogP | 2.30 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|