C35H45F3O4Si — CID 169126102
ethyl (2R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-2-phenylmethoxy-2-(trifluoromethyl)nonanoate (PubChem CID 169126102) has the molecular formula C35H45F3O4Si and a molecular weight of 614.82 g/mol. Its IUPAC name is ethyl (2R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-2-phenylmethoxy-2-(trifluoromethyl)nonanoate.
| Compound Name | ethyl (2R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-2-phenylmethoxy-2-(trifluoromethyl)nonanoate |
|---|---|
| PubChem CID | 169126102 |
| Molecular Formula | C35H45F3O4Si |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.30 |
| IUPAC Name | ethyl (2R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-2-phenylmethoxy-2-(trifluoromethyl)nonanoate |
| SMILES | CCOC(=O)[C@@](CCCCC[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C35H45F3O4Si/c1-6-40-32(39)34(35(36,37)38,41-27-29-20-12-7-13-21-29)26-18-10-11-19-28(2)42-43(33(3,4)5,30-22-14-8-15-23-30)31-24-16-9-17-25-31/h7-9,12-17,20-25,28H,6,10-11,18-19,26-27H2,1-5H3/t28-,34+/m0/s1 |
| InChIKey | LEMOFXYGKSTDQV-IPZQJPLYSA-N |
| XLogP | 7.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|