C25H25F3N4O5 — CID 169126103
2-[3-nitro-6-[(2R)-pent-4-en-2-yl]oxy-5-(trifluoromethyl)-2-pyridinyl]-5-(1-phenylmethoxypent-4-enyl)-1,3,4-oxadiazole (PubChem CID 169126103) has the molecular formula C25H25F3N4O5 and a molecular weight of 518.49 g/mol. Its IUPAC name is 2-[3-nitro-6-[(2R)-pent-4-en-2-yl]oxy-5-(trifluoromethyl)-2-pyridinyl]-5-(1-phenylmethoxypent-4-enyl)-1,3,4-oxadiazole.
| Compound Name | 2-[3-nitro-6-[(2R)-pent-4-en-2-yl]oxy-5-(trifluoromethyl)-2-pyridinyl]-5-(1-phenylmethoxypent-4-enyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 169126103 |
| Molecular Formula | C25H25F3N4O5 |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 2-[3-nitro-6-[(2R)-pent-4-en-2-yl]oxy-5-(trifluoromethyl)-2-pyridinyl]-5-(1-phenylmethoxypent-4-enyl)-1,3,4-oxadiazole |
| SMILES | C=CCCC(OCc1ccccc1)c1nnc(-c2nc(O[C@H](C)CC=C)c(C(F)(F)F)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C25H25F3N4O5/c1-4-6-13-20(35-15-17-11-8-7-9-12-17)23-30-31-24(37-23)21-19(32(33)34)14-18(25(26,27)28)22(29-21)36-16(3)10-5-2/h4-5,7-9,11-12,14,16,20H,1-2,6,10,13,15H2,3H3/t16-,20?/m1/s1 |
| InChIKey | OFKPYNDPOHNITJ-QRIPLOBPSA-N |
| XLogP | 6.63 |
| TPSA | 113.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|