C21H28N2O2 — CID 169127135
12-(3,4-dihydro-2H-pyrrol-2-yl)-4,7,7-trimethyl-11-propyl-8-oxa-10-azatricyclo[7.4.0.02,6]trideca-1(9),3,11-trien-13-one (PubChem CID 169127135) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 12-(3,4-dihydro-2H-pyrrol-2-yl)-4,7,7-trimethyl-11-propyl-8-oxa-10-azatricyclo[7.4.0.02,6]trideca-1(9),3,11-trien-13-one.
| Compound Name | 12-(3,4-dihydro-2H-pyrrol-2-yl)-4,7,7-trimethyl-11-propyl-8-oxa-10-azatricyclo[7.4.0.02,6]trideca-1(9),3,11-trien-13-one |
|---|---|
| PubChem CID | 169127135 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 12-(3,4-dihydro-2H-pyrrol-2-yl)-4,7,7-trimethyl-11-propyl-8-oxa-10-azatricyclo[7.4.0.02,6]trideca-1(9),3,11-trien-13-one |
| SMILES | CCCc1[nH]c2c(c(=O)c1C1CCC=N1)C1C=C(C)CC1C(C)(C)O2 |
| InChI | InChI=1S/C21H28N2O2/c1-5-7-16-18(15-8-6-9-22-15)19(24)17-13-10-12(2)11-14(13)21(3,4)25-20(17)23-16/h9-10,13-15H,5-8,11H2,1-4H3,(H,23,24) |
| InChIKey | PVBSHHOYNIOWTQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|