About CID 169127216
CID 169127216 (PubChem CID 169127216) has the molecular formula C24H17B6ClFN3O6
and a molecular weight of 562.74 g/mol.
Molecular Properties
| Compound Name | CID 169127216 |
| PubChem CID | 169127216 |
| Molecular Formula | C24H17B6ClFN3O6 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | — |
| SMILES | O=CN1Cc2c(F)cccc2O1.[B]C([B])([B])N(C(=O)CN1C(=O)c2oc3ccc(Cl)cc3c2OCC1C)C([B])([B])[B] |
| InChI | InChI=1S/C16H11B6ClN2O4.C8H6FNO2/c1-7-6-28-12-9-4-8(23)2-3-10(9)29-13(12)14(27)24(7)5-11(26)25(15(17,18)19)16(20,21)22;9-7-2-1-3-8-6(7)4-10(5-11)12-8/h2-4,7H,5-6H2,1H3;1-3,5H,4H2 |
| InChIKey | JIVXEXUHPUQUSO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 92.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169127216 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169127216?
The IUPAC name of CID 169127216 (CID 169127216) is not available.
What is the SMILES notation for CID 169127216?
The canonical SMILES for CID 169127216 is O=CN1Cc2c(F)cccc2O1.[B]C([B])([B])N(C(=O)CN1C(=O)c2oc3ccc(Cl)cc3c2OCC1C)C([B])([B])[B].
What is the InChIKey of CID 169127216?
The InChIKey is JIVXEXUHPUQUSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11B6ClN2O4.C8H6FNO2/c1-7-6-28-12-9-4-8(23)2-3-10(9)29-13(12)14(27)24(7)5-11(26)25(15(17,18)19)16(20,21)22;9-7-2-1-3-8-6(7)4-10(5-11)12-8/h2-4,7H,5-6H2,1H3;1-3,5H,4H2.
What are the key properties of CID 169127216?
CID 169127216 has a molecular weight of 562.74 g/mol, XLogP of 0.46, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169127216 is sourced from PubChem (CID 169127216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).