C23H26N2O8V — CID 169127441
hydrogen peroxide;N-[(2-hydroxyphenyl)methyl]-4-(2-methoxyethyl)-3-methyl-5-oxo-2H-[1]benzofuro[2,3-f][1,4]oxazepine-3-carboxamide;vanadium (PubChem CID 169127441) has the molecular formula C23H26N2O8V and a molecular weight of 509.41 g/mol. Its IUPAC name is hydrogen peroxide;N-[(2-hydroxyphenyl)methyl]-4-(2-methoxyethyl)-3-methyl-5-oxo-2H-[1]benzofuro[2,3-f][1,4]oxazepine-3-carboxamide;vanadium.
| Compound Name | hydrogen peroxide;N-[(2-hydroxyphenyl)methyl]-4-(2-methoxyethyl)-3-methyl-5-oxo-2H-[1]benzofuro[2,3-f][1,4]oxazepine-3-carboxamide;vanadium |
|---|---|
| PubChem CID | 169127441 |
| Molecular Formula | C23H26N2O8V |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | hydrogen peroxide;N-[(2-hydroxyphenyl)methyl]-4-(2-methoxyethyl)-3-methyl-5-oxo-2H-[1]benzofuro[2,3-f][1,4]oxazepine-3-carboxamide;vanadium |
| SMILES | COCCN1C(=O)c2oc3ccccc3c2OCC1(C)C(=O)NCc1ccccc1O.OO.[V] |
| InChI | InChI=1S/C23H24N2O6.H2O2.V/c1-23(22(28)24-13-15-7-3-5-9-17(15)26)14-30-19-16-8-4-6-10-18(16)31-20(19)21(27)25(23)11-12-29-2;1-2;/h3-10,26H,11-14H2,1-2H3,(H,24,28);1-2H; |
| InChIKey | XAIFKFZYIDCPIJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|