C27H33F3N4O6 — CID 169127512
2-[5-(1,1-difluoroethyl)-12-methyl-10-oxo-8,14-dioxa-3,11-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-11-yl]-N,N-dimethylacetamide;ethane;N-[(2-fluoro-6-hydroxyphenyl)methyl]formamide (PubChem CID 169127512) has the molecular formula C27H33F3N4O6 and a molecular weight of 566.58 g/mol. Its IUPAC name is 2-[5-(1,1-difluoroethyl)-12-methyl-10-oxo-8,14-dioxa-3,11-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-11-yl]-N,N-dimethylacetamide;ethane;N-[(2-fluoro-6-hydroxyphenyl)methyl]formamide.
| Compound Name | 2-[5-(1,1-difluoroethyl)-12-methyl-10-oxo-8,14-dioxa-3,11-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-11-yl]-N,N-dimethylacetamide;ethane;N-[(2-fluoro-6-hydroxyphenyl)methyl]formamide |
|---|---|
| PubChem CID | 169127512 |
| Molecular Formula | C27H33F3N4O6 |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 2-[5-(1,1-difluoroethyl)-12-methyl-10-oxo-8,14-dioxa-3,11-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-11-yl]-N,N-dimethylacetamide;ethane;N-[(2-fluoro-6-hydroxyphenyl)methyl]formamide |
| SMILES | CC.CC1COc2c(oc3cc(C(C)(F)F)cnc23)C(=O)N1CC(=O)N(C)C.O=CNCc1c(O)cccc1F |
| InChI | InChI=1S/C17H19F2N3O4.C8H8FNO2.C2H6/c1-9-8-25-14-13-11(5-10(6-20-13)17(2,18)19)26-15(14)16(24)22(9)7-12(23)21(3)4;9-7-2-1-3-8(12)6(7)4-10-5-11;1-2/h5-6,9H,7-8H2,1-4H3;1-3,5,12H,4H2,(H,10,11);1-2H3 |
| InChIKey | PIIMYCVXPNQTFU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|