About acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium
acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium (PubChem CID 169128104) has the molecular formula C13H22N3ORe-
and a molecular weight of 422.55 g/mol. Its IUPAC name is acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium.
Molecular Properties
| Compound Name | acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium |
| PubChem CID | 169128104 |
| Molecular Formula | C13H22N3ORe- |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium |
| SMILES | CC#N.[CH2-]/C=C/C(=O)N1CCN(C(C)C)CC1.[Re] |
| InChI | InChI=1S/C11H19N2O.C2H3N.Re/c1-4-5-11(14)13-8-6-12(7-9-13)10(2)3;1-2-3;/h4-5,10H,1,6-9H2,2-3H3;1H3;/q-1;;/b5-4+;; |
| InChIKey | URIXGLLGYGKNAB-SFKRKKMESA-N |
| XLogP | 1.46 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium?
The IUPAC name of acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium (CID 169128104) is acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium.
What is the SMILES notation for acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium?
The canonical SMILES for acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium is CC#N.[CH2-]/C=C/C(=O)N1CCN(C(C)C)CC1.[Re].
What is the InChIKey of acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium?
The InChIKey is URIXGLLGYGKNAB-SFKRKKMESA-N. The full InChI is InChI=1S/C11H19N2O.C2H3N.Re/c1-4-5-11(14)13-8-6-12(7-9-13)10(2)3;1-2-3;/h4-5,10H,1,6-9H2,2-3H3;1H3;/q-1;;/b5-4+;;.
What are the key properties of acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium?
acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium has a molecular weight of 422.55 g/mol, XLogP of 1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;(E)-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one;rhenium is sourced from PubChem (CID 169128104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).